About 5-ethyl-2-phenyl-1,3-thiazol-4-ol
5-ethyl-2-phenyl-1,3-thiazol-4-ol (PubChem CID 13484654) has the molecular formula C11H11NOS
and a molecular weight of 205.28 g/mol. Its IUPAC name is 5-ethyl-2-phenyl-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 5-ethyl-2-phenyl-1,3-thiazol-4-ol |
| PubChem CID | 13484654 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 5-ethyl-2-phenyl-1,3-thiazol-4-ol |
| SMILES | CCc1sc(-c2ccccc2)nc1O |
| InChI | InChI=1S/C11H11NOS/c1-2-9-10(13)12-11(14-9)8-6-4-3-5-7-8/h3-7,13H,2H2,1H3 |
| InChIKey | GANZRYZOGSWXLR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-2-phenyl-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-phenyl-1,3-thiazol-4-ol?
The IUPAC name of 5-ethyl-2-phenyl-1,3-thiazol-4-ol (CID 13484654) is 5-ethyl-2-phenyl-1,3-thiazol-4-ol.
What is the SMILES notation for 5-ethyl-2-phenyl-1,3-thiazol-4-ol?
The canonical SMILES for 5-ethyl-2-phenyl-1,3-thiazol-4-ol is CCc1sc(-c2ccccc2)nc1O.
What is the InChIKey of 5-ethyl-2-phenyl-1,3-thiazol-4-ol?
The InChIKey is GANZRYZOGSWXLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS/c1-2-9-10(13)12-11(14-9)8-6-4-3-5-7-8/h3-7,13H,2H2,1H3.
What are the key properties of 5-ethyl-2-phenyl-1,3-thiazol-4-ol?
5-ethyl-2-phenyl-1,3-thiazol-4-ol has a molecular weight of 205.28 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-phenyl-1,3-thiazol-4-ol is sourced from PubChem (CID 13484654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).