C24H28N2O2S — CID 134846614
(4aR,8aS)-4,4,7-trimethyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4a,5,6,8a-tetrahydroquinazoline (PubChem CID 134846614) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is (4aR,8aS)-4,4,7-trimethyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4a,5,6,8a-tetrahydroquinazoline.
| Compound Name | (4aR,8aS)-4,4,7-trimethyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4a,5,6,8a-tetrahydroquinazoline |
|---|---|
| PubChem CID | 134846614 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (4aR,8aS)-4,4,7-trimethyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4a,5,6,8a-tetrahydroquinazoline |
| SMILES | CC1=C[C@H]2[C@@H](CC1)C(C)(C)N=C(c1ccccc1)N2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28N2O2S/c1-17-10-13-20(14-11-17)29(27,28)26-22-16-18(2)12-15-21(22)24(3,4)25-23(26)19-8-6-5-7-9-19/h5-11,13-14,16,21-22H,12,15H2,1-4H3/t21-,22+/m1/s1 |
| InChIKey | WALIGEIGNVFQAF-YADHBBJMSA-N |
| XLogP | 4.95 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|