C34H37NO5S — CID 134846652
4-methyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]benzenesulfonamide (PubChem CID 134846652) has the molecular formula C34H37NO5S and a molecular weight of 571.74 g/mol. Its IUPAC name is 4-methyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134846652 |
| Molecular Formula | C34H37NO5S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 4-methyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]benzenesulfonamide |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H37NO5S/c1-3-33(39-24-29-15-9-5-10-16-29)34(40-25-30-17-11-6-12-18-30)32(26-38-23-28-13-7-4-8-14-28)35-41(36,37)31-21-19-27(2)20-22-31/h3-22,32-35H,1,23-26H2,2H3/t32-,33-,34-/m1/s1 |
| InChIKey | YXIDWTRMYRQDHI-CKOYEXALSA-N |
| XLogP | 6.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|