C15H22F2O2 — CID 134846672
2,2-difluoro-1-phenylmethoxyoctan-3-ol (PubChem CID 134846672) has the molecular formula C15H22F2O2 and a molecular weight of 272.33 g/mol. Its IUPAC name is 2,2-difluoro-1-phenylmethoxyoctan-3-ol.
| Compound Name | 2,2-difluoro-1-phenylmethoxyoctan-3-ol |
|---|---|
| PubChem CID | 134846672 |
| Molecular Formula | C15H22F2O2 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2,2-difluoro-1-phenylmethoxyoctan-3-ol |
| SMILES | CCCCCC(O)C(F)(F)COCc1ccccc1 |
| InChI | InChI=1S/C15H22F2O2/c1-2-3-5-10-14(18)15(16,17)12-19-11-13-8-6-4-7-9-13/h4,6-9,14,18H,2-3,5,10-12H2,1H3 |
| InChIKey | UNOSDYXVHYCXCI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|