C22H27NO6 — CID 134846713
triethyl (E)-6-cyano-6-phenylhex-3-ene-1,1,6-tricarboxylate (PubChem CID 134846713) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is triethyl (E)-6-cyano-6-phenylhex-3-ene-1,1,6-tricarboxylate.
| Compound Name | triethyl (E)-6-cyano-6-phenylhex-3-ene-1,1,6-tricarboxylate |
|---|---|
| PubChem CID | 134846713 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | triethyl (E)-6-cyano-6-phenylhex-3-ene-1,1,6-tricarboxylate |
| SMILES | CCOC(=O)C(C/C=C/CC(C#N)(C(=O)OCC)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C22H27NO6/c1-4-27-19(24)18(20(25)28-5-2)14-10-11-15-22(16-23,21(26)29-6-3)17-12-8-7-9-13-17/h7-13,18H,4-6,14-15H2,1-3H3/b11-10+ |
| InChIKey | QYIFPDWULOBQRX-ZHACJKMWSA-N |
| XLogP | 3.09 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|