C13H20O5 — CID 134846911
(5R)-5-[(E,1R)-1-hydroxy-3-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]prop-2-enyl]oxolan-2-one (PubChem CID 134846911) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (5R)-5-[(E,1R)-1-hydroxy-3-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]prop-2-enyl]oxolan-2-one.
| Compound Name | (5R)-5-[(E,1R)-1-hydroxy-3-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]prop-2-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 134846911 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (5R)-5-[(E,1R)-1-hydroxy-3-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]prop-2-enyl]oxolan-2-one |
| SMILES | C[C@@H]1OC(C)(C)O[C@@H]1/C=C/[C@@H](O)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C13H20O5/c1-8-10(18-13(2,3)17-8)5-4-9(14)11-6-7-12(15)16-11/h4-5,8-11,14H,6-7H2,1-3H3/b5-4+/t8-,9+,10+,11+/m0/s1 |
| InChIKey | ATMDXGKEXQPZRN-ZHUQGDDZSA-N |
| XLogP | 1.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|