C24H37NO2 — CID 134846928
(3R,10R,11R)-3,11-diethyl-10-phenylmethoxy-1-azacyclotetradec-5-en-2-one (PubChem CID 134846928) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is (3R,10R,11R)-3,11-diethyl-10-phenylmethoxy-1-azacyclotetradec-5-en-2-one.
| Compound Name | (3R,10R,11R)-3,11-diethyl-10-phenylmethoxy-1-azacyclotetradec-5-en-2-one |
|---|---|
| PubChem CID | 134846928 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | (3R,10R,11R)-3,11-diethyl-10-phenylmethoxy-1-azacyclotetradec-5-en-2-one |
| SMILES | CC[C@@H]1CC=CCCC[C@@H](OCc2ccccc2)[C@H](CC)CCCNC1=O |
| InChI | InChI=1S/C24H37NO2/c1-3-21-16-12-18-25-24(26)22(4-2)15-10-5-6-11-17-23(21)27-19-20-13-8-7-9-14-20/h5,7-10,13-14,21-23H,3-4,6,11-12,15-19H2,1-2H3,(H,25,26)/t21-,22-,23-/m1/s1 |
| InChIKey | MIJYPPLDTRWNSF-DNVJHFABSA-N |
| XLogP | 5.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|