C26H52O5Si2 — CID 134846994
methyl (Z)-4-[(4R,5S,6S)-2,2-ditert-butyl-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-1,3,2-dioxasilinan-4-yl]pent-3-enoate (PubChem CID 134846994) has the molecular formula C26H52O5Si2 and a molecular weight of 500.87 g/mol. Its IUPAC name is methyl (Z)-4-[(4R,5S,6S)-2,2-ditert-butyl-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-1,3,2-dioxasilinan-4-yl]pent-3-enoate.
| Compound Name | methyl (Z)-4-[(4R,5S,6S)-2,2-ditert-butyl-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-1,3,2-dioxasilinan-4-yl]pent-3-enoate |
|---|---|
| PubChem CID | 134846994 |
| Molecular Formula | C26H52O5Si2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | methyl (Z)-4-[(4R,5S,6S)-2,2-ditert-butyl-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-1,3,2-dioxasilinan-4-yl]pent-3-enoate |
| SMILES | COC(=O)C/C=C(/C)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C26H52O5Si2/c1-19(15-16-22(27)28-12)23-20(2)21(17-18-29-32(13,14)24(3,4)5)30-33(31-23,25(6,7)8)26(9,10)11/h15,20-21,23H,16-18H2,1-14H3/b19-15-/t20-,21-,23-/m0/s1 |
| InChIKey | CMPXDLWSIYYSCZ-PHQPFNMISA-N |
| XLogP | 7.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|