C10H11NO3 — CID 134847029
ethyl 5-cyano-2-ethenyl-2,3-dihydrofuran-4-carboxylate (PubChem CID 134847029) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is ethyl 5-cyano-2-ethenyl-2,3-dihydrofuran-4-carboxylate.
| Compound Name | ethyl 5-cyano-2-ethenyl-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 134847029 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | ethyl 5-cyano-2-ethenyl-2,3-dihydrofuran-4-carboxylate |
| SMILES | C=CC1CC(C(=O)OCC)=C(C#N)O1 |
| InChI | InChI=1S/C10H11NO3/c1-3-7-5-8(9(6-11)14-7)10(12)13-4-2/h3,7H,1,4-5H2,2H3 |
| InChIKey | DBOOWQRHRUTKGV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|