C25H33NO5 — CID 134847062
tert-butyl N-[(2R,3R,4R)-1-hydroxy-3,4-bis(phenylmethoxy)hex-5-en-2-yl]carbamate (PubChem CID 134847062) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,4R)-1-hydroxy-3,4-bis(phenylmethoxy)hex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,4R)-1-hydroxy-3,4-bis(phenylmethoxy)hex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134847062 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | tert-butyl N-[(2R,3R,4R)-1-hydroxy-3,4-bis(phenylmethoxy)hex-5-en-2-yl]carbamate |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H33NO5/c1-5-22(29-17-19-12-8-6-9-13-19)23(30-18-20-14-10-7-11-15-20)21(16-27)26-24(28)31-25(2,3)4/h5-15,21-23,27H,1,16-18H2,2-4H3,(H,26,28)/t21-,22-,23-/m1/s1 |
| InChIKey | WAXUGRNBDVGVLQ-DNVJHFABSA-N |
| XLogP | 4.23 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|