C25H29NO4 — CID 134847065
(4R)-4-[(1R,2R)-1,2-bis(phenylmethoxy)but-3-enyl]-3-but-3-enyl-1,3-oxazolidin-2-one (PubChem CID 134847065) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is (4R)-4-[(1R,2R)-1,2-bis(phenylmethoxy)but-3-enyl]-3-but-3-enyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[(1R,2R)-1,2-bis(phenylmethoxy)but-3-enyl]-3-but-3-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134847065 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (4R)-4-[(1R,2R)-1,2-bis(phenylmethoxy)but-3-enyl]-3-but-3-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CCCN1C(=O)OC[C@@H]1[C@@H](OCc1ccccc1)[C@@H](C=C)OCc1ccccc1 |
| InChI | InChI=1S/C25H29NO4/c1-3-5-16-26-22(19-30-25(26)27)24(29-18-21-14-10-7-11-15-21)23(4-2)28-17-20-12-8-6-9-13-20/h3-4,6-15,22-24H,1-2,5,16-19H2/t22-,23-,24-/m1/s1 |
| InChIKey | VKVOJICJMGOQMY-WXFUMESZSA-N |
| XLogP | 4.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|