C15H23O2Pd- — CID 134847077
carbanide;2-[(7S,8R)-7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl]prop-2-enylidenepalladium (PubChem CID 134847077) has the molecular formula C15H23O2Pd- and a molecular weight of 341.77 g/mol. Its IUPAC name is carbanide;2-[(7S,8R)-7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl]prop-2-enylidenepalladium.
| Compound Name | carbanide;2-[(7S,8R)-7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl]prop-2-enylidenepalladium |
|---|---|
| PubChem CID | 134847077 |
| Molecular Formula | C15H23O2Pd- |
| Molecular Weight | 341.77 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | carbanide;2-[(7S,8R)-7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl]prop-2-enylidenepalladium |
| SMILES | C=C[C@]1(C)CC2(CC[C@H]1C(=C)C=[Pd])OCCO2.[CH3-] |
| InChI | InChI=1S/C14H20O2.CH3.Pd/c1-5-13(4)10-14(15-8-9-16-14)7-6-12(13)11(2)3;;/h2,5,12H,1,3,6-10H2,4H3;1H3;/q;-1;/t12-,13+;;/m0../s1 |
| InChIKey | GRFPDQHHECTLHG-CQSOCPNPSA-N |
| XLogP | 3.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.77 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|