About neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide
neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide (PubChem CID 134847083) has the molecular formula C17H16NNpO2-
and a molecular weight of 503.32 g/mol. Its IUPAC name is neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide.
Molecular Properties
| Compound Name | neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide |
| PubChem CID | 134847083 |
| Molecular Formula | C17H16NNpO2- |
| Molecular Weight | 503.32 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide |
| SMILES | C=C[CH-]N(OCc1ccccc1)C(=O)c1ccccc1.[Np] |
| InChI | InChI=1S/C17H16NO2.Np/c1-2-13-18(17(19)16-11-7-4-8-12-16)20-14-15-9-5-3-6-10-15;/h2-13H,1,14H2;/q-1; |
| InChIKey | KJGDLRDTKSZEDN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide?
The IUPAC name of neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide (CID 134847083) is neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide.
What is the SMILES notation for neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide?
The canonical SMILES for neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide is C=C[CH-]N(OCc1ccccc1)C(=O)c1ccccc1.[Np].
What is the InChIKey of neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide?
The InChIKey is KJGDLRDTKSZEDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16NO2.Np/c1-2-13-18(17(19)16-11-7-4-8-12-16)20-14-15-9-5-3-6-10-15;/h2-13H,1,14H2;/q-1;.
What are the key properties of neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide?
neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide has a molecular weight of 503.32 g/mol, XLogP of 3.61, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for neptunium;N-phenylmethoxy-N-prop-2-enylbenzamide is sourced from PubChem (CID 134847083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).