About 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid
4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid (PubChem CID 134847190) has the molecular formula C24H25NO8
and a molecular weight of 455.46 g/mol. Its IUPAC name is 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid |
| PubChem CID | 134847190 |
| Molecular Formula | C24H25NO8 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)O[C@@H]1C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C24H25NO8/c26-21(27)11-12-22(28)33-19-13-20(23(29)31-15-17-7-3-1-4-8-17)25(14-19)24(30)32-16-18-9-5-2-6-10-18/h1-10,19-20H,11-16H2,(H,26,27)/t19-,20+/m1/s1 |
| InChIKey | AGVTXMADSOZLMF-UXHICEINSA-N |
| XLogP | 2.92 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid?
The IUPAC name of 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid (CID 134847190) is 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid.
What is the SMILES notation for 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid?
The canonical SMILES for 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid is O=C(O)CCC(=O)O[C@@H]1C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1.
What is the InChIKey of 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid?
The InChIKey is AGVTXMADSOZLMF-UXHICEINSA-N. The full InChI is InChI=1S/C24H25NO8/c26-21(27)11-12-22(28)33-19-13-20(23(29)31-15-17-7-3-1-4-8-17)25(14-19)24(30)32-16-18-9-5-2-6-10-18/h1-10,19-20H,11-16H2,(H,26,27)/t19-,20+/m1/s1.
What are the key properties of 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid?
4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid has a molecular weight of 455.46 g/mol, XLogP of 2.92, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R,5S)-1,5-bis(phenylmethoxycarbonyl)pyrrolidin-3-yl]oxy-4-oxobutanoic acid is sourced from PubChem (CID 134847190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).