About tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate
tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate (PubChem CID 134847432) has the molecular formula C20H22FNO2
and a molecular weight of 327.40 g/mol. Its IUPAC name is tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate |
| PubChem CID | 134847432 |
| Molecular Formula | C20H22FNO2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccccc2)CC1(F)c1ccccc1 |
| InChI | InChI=1S/C20H22FNO2/c1-18(2,3)24-17(23)22-20(16-12-8-5-9-13-16)14-19(20,21)15-10-6-4-7-11-15/h4-13H,14H2,1-3H3,(H,22,23) |
| InChIKey | BJZAMXFOVXEKDR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate?
The IUPAC name of tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate (CID 134847432) is tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate.
What is the SMILES notation for tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate?
The canonical SMILES for tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate is CC(C)(C)OC(=O)NC1(c2ccccc2)CC1(F)c1ccccc1.
What is the InChIKey of tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate?
The InChIKey is BJZAMXFOVXEKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FNO2/c1-18(2,3)24-17(23)22-20(16-12-8-5-9-13-16)14-19(20,21)15-10-6-4-7-11-15/h4-13H,14H2,1-3H3,(H,22,23).
What are the key properties of tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate?
tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate has a molecular weight of 327.40 g/mol, XLogP of 4.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-fluoro-1,2-diphenylcyclopropyl)carbamate is sourced from PubChem (CID 134847432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).