About (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine
(1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine (PubChem CID 134847442) has the molecular formula C17H30NO4P
and a molecular weight of 343.40 g/mol. Its IUPAC name is (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine.
Molecular Properties
| Compound Name | (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine |
| PubChem CID | 134847442 |
| Molecular Formula | C17H30NO4P |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine |
| SMILES | CCOC(C)(OCC)P(=O)(CN[C@@H](C)c1ccccc1)OCC |
| InChI | InChI=1S/C17H30NO4P/c1-6-20-17(5,21-7-2)23(19,22-8-3)14-18-15(4)16-12-10-9-11-13-16/h9-13,15,18H,6-8,14H2,1-5H3/t15-,23?/m0/s1 |
| InChIKey | NOUSGZLQQKAQAC-NGMICRHFSA-N |
| XLogP | 4.36 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine?
The IUPAC name of (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine (CID 134847442) is (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine.
What is the SMILES notation for (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine?
The canonical SMILES for (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine is CCOC(C)(OCC)P(=O)(CN[C@@H](C)c1ccccc1)OCC.
What is the InChIKey of (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine?
The InChIKey is NOUSGZLQQKAQAC-NGMICRHFSA-N. The full InChI is InChI=1S/C17H30NO4P/c1-6-20-17(5,21-7-2)23(19,22-8-3)14-18-15(4)16-12-10-9-11-13-16/h9-13,15,18H,6-8,14H2,1-5H3/t15-,23?/m0/s1.
What are the key properties of (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine?
(1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine has a molecular weight of 343.40 g/mol, XLogP of 4.36, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-[[1,1-diethoxyethyl(ethoxy)phosphoryl]methyl]-1-phenylethanamine is sourced from PubChem (CID 134847442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).