C15H19N3O3S2 — CID 134847789
(2R,4R,5R,6R)-4-(azidomethyl)-6-(1,3-dithian-2-yl)-2-phenyl-1,3-dioxan-5-ol (PubChem CID 134847789) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (2R,4R,5R,6R)-4-(azidomethyl)-6-(1,3-dithian-2-yl)-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (2R,4R,5R,6R)-4-(azidomethyl)-6-(1,3-dithian-2-yl)-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 134847789 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (2R,4R,5R,6R)-4-(azidomethyl)-6-(1,3-dithian-2-yl)-2-phenyl-1,3-dioxan-5-ol |
| SMILES | [N-]=[N+]=NC[C@H]1O[C@@H](c2ccccc2)O[C@@H](C2SCCCS2)[C@@H]1O |
| InChI | InChI=1S/C15H19N3O3S2/c16-18-17-9-11-12(19)13(15-22-7-4-8-23-15)21-14(20-11)10-5-2-1-3-6-10/h1-3,5-6,11-15,19H,4,7-9H2/t11-,12-,13-,14-/m1/s1 |
| InChIKey | GFRAXYFIVVEIHE-AAVRWANBSA-N |
| XLogP | 3.34 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|