C31H31O2P2+ — CID 134847983
[(4R,5R)-5-(diphenylphosphanylmethyl)-2-methyl-2-methyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane (PubChem CID 134847983) has the molecular formula C31H31O2P2+ and a molecular weight of 497.54 g/mol. Its IUPAC name is [(4R,5R)-5-(diphenylphosphanylmethyl)-2-methyl-2-methyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane.
| Compound Name | [(4R,5R)-5-(diphenylphosphanylmethyl)-2-methyl-2-methyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 134847983 |
| Molecular Formula | C31H31O2P2+ |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [(4R,5R)-5-(diphenylphosphanylmethyl)-2-methyl-2-methyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane |
| SMILES | [CH2+]C1(C)O[C@@H](CP(c2ccccc2)c2ccccc2)[C@H](CP(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C31H31O2P2/c1-31(2)32-29(23-34(25-15-7-3-8-16-25)26-17-9-4-10-18-26)30(33-31)24-35(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22,29-30H,1,23-24H2,2H3/q+1/t29-,30-/m0/s1 |
| InChIKey | IWTHAVOYKFQSSI-KYJUHHDHSA-N |
| XLogP | 5.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|