C46H47NO9 — CID 134848012
benzyl N-[(1R,2S,3S,4R,5R)-4-hydroxy-1-(5-oxo-2H-furan-2-yl)-2,3,5,6-tetrakis(phenylmethoxy)hexyl]carbamate (PubChem CID 134848012) has the molecular formula C46H47NO9 and a molecular weight of 757.88 g/mol. Its IUPAC name is benzyl N-[(1R,2S,3S,4R,5R)-4-hydroxy-1-(5-oxo-2H-furan-2-yl)-2,3,5,6-tetrakis(phenylmethoxy)hexyl]carbamate.
| Compound Name | benzyl N-[(1R,2S,3S,4R,5R)-4-hydroxy-1-(5-oxo-2H-furan-2-yl)-2,3,5,6-tetrakis(phenylmethoxy)hexyl]carbamate |
|---|---|
| PubChem CID | 134848012 |
| Molecular Formula | C46H47NO9 |
| Molecular Weight | 757.88 g/mol |
| Exact Mass | 757.33 |
| IUPAC Name | benzyl N-[(1R,2S,3S,4R,5R)-4-hydroxy-1-(5-oxo-2H-furan-2-yl)-2,3,5,6-tetrakis(phenylmethoxy)hexyl]carbamate |
| SMILES | O=C1C=CC([C@@H](NC(=O)OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](O)[C@@H](COCc2ccccc2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C46H47NO9/c48-41-27-26-39(56-41)42(47-46(50)55-32-38-24-14-5-15-25-38)44(53-30-36-20-10-3-11-21-36)45(54-31-37-22-12-4-13-23-37)43(49)40(52-29-35-18-8-2-9-19-35)33-51-28-34-16-6-1-7-17-34/h1-27,39-40,42-45,49H,28-33H2,(H,47,50)/t39?,40-,42-,43-,44+,45+/m1/s1 |
| InChIKey | ICIYMSLTJLBAIB-XQWUOXNPSA-N |
| XLogP | 7.10 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.88 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |