C18H26N6 — CID 134848035
3-[1-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)ethenyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole (PubChem CID 134848035) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is 3-[1-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)ethenyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole.
| Compound Name | 3-[1-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)ethenyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole |
|---|---|
| PubChem CID | 134848035 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3-[1-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)ethenyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole |
| SMILES | C=C(n1nnc2c1CCCCCC2)n1nnc2c1CCCCCC2 |
| InChI | InChI=1S/C18H26N6/c1-14(23-17-12-8-4-2-6-10-15(17)19-21-23)24-18-13-9-5-3-7-11-16(18)20-22-24/h1-13H2 |
| InChIKey | XDTZGDPATPVXRQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |