C12H16FNO2 — CID 134848052
(2S,3S)-3-(4-fluorophenyl)-2,4-dimethylmorpholin-2-ol (PubChem CID 134848052) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is (2S,3S)-3-(4-fluorophenyl)-2,4-dimethylmorpholin-2-ol.
| Compound Name | (2S,3S)-3-(4-fluorophenyl)-2,4-dimethylmorpholin-2-ol |
|---|---|
| PubChem CID | 134848052 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (2S,3S)-3-(4-fluorophenyl)-2,4-dimethylmorpholin-2-ol |
| SMILES | CN1CCO[C@](C)(O)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C12H16FNO2/c1-12(15)11(14(2)7-8-16-12)9-3-5-10(13)6-4-9/h3-6,11,15H,7-8H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | OPLRHDDSFZTMGG-RYUDHWBXSA-N |
| XLogP | 1.54 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |