C12H20O2 — CID 134848089
(3S,3aS,8R)-8-hydroxy-3,8-dimethyl-1,2,3,3a,4,6,7,8a-octahydroazulen-5-one (PubChem CID 134848089) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (3S,3aS,8R)-8-hydroxy-3,8-dimethyl-1,2,3,3a,4,6,7,8a-octahydroazulen-5-one.
| Compound Name | (3S,3aS,8R)-8-hydroxy-3,8-dimethyl-1,2,3,3a,4,6,7,8a-octahydroazulen-5-one |
|---|---|
| PubChem CID | 134848089 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3S,3aS,8R)-8-hydroxy-3,8-dimethyl-1,2,3,3a,4,6,7,8a-octahydroazulen-5-one |
| SMILES | C[C@H]1CCC2[C@H]1CC(=O)CC[C@@]2(C)O |
| InChI | InChI=1S/C12H20O2/c1-8-3-4-11-10(8)7-9(13)5-6-12(11,2)14/h8,10-11,14H,3-7H2,1-2H3/t8-,10-,11?,12+/m0/s1 |
| InChIKey | ZOXCSPSELGUISI-ZSFDITPASA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |