C9H14N3Y- — CID 134848178
3-methanidyl-4,5,6,7,8,9-hexahydrocycloocta[d]triazole;yttrium (PubChem CID 134848178) has the molecular formula C9H14N3Y- and a molecular weight of 253.14 g/mol. Its IUPAC name is 3-methanidyl-4,5,6,7,8,9-hexahydrocycloocta[d]triazole;yttrium.
| Compound Name | 3-methanidyl-4,5,6,7,8,9-hexahydrocycloocta[d]triazole;yttrium |
|---|---|
| PubChem CID | 134848178 |
| Molecular Formula | C9H14N3Y- |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 3-methanidyl-4,5,6,7,8,9-hexahydrocycloocta[d]triazole;yttrium |
| SMILES | [CH2-]n1nnc2c1CCCCCC2.[Y] |
| InChI | InChI=1S/C9H14N3.Y/c1-12-9-7-5-3-2-4-6-8(9)10-11-12;/h1-7H2;/q-1; |
| InChIKey | ZEMQXSOZHBSBQD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|