About 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione
6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione (PubChem CID 13484842) has the molecular formula C6H11N3O3
and a molecular weight of 173.17 g/mol. Its IUPAC name is 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione.
Analyze 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione?
The IUPAC name of 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione (CID 13484842) is 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione.
What is the SMILES notation for 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione?
The canonical SMILES for 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione is CN1C(=O)N(C)C(O)N(C)C1=O.
What is the InChIKey of 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione?
The InChIKey is XEEOAAKGCIPCMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O3/c1-7-4(10)8(2)6(12)9(3)5(7)11/h4,10H,1-3H3.
What are the key properties of 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione?
6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione has a molecular weight of 173.17 g/mol, XLogP of -0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1,3,5-trimethyl-1,3,5-triazinane-2,4-dione is sourced from PubChem (CID 13484842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).