C32H35ClN2O3RuS — CID 134848475
carbanide;chlororuthenium(3+);2-[(4-methylphenyl)methoxy]ethyl-[(1R,2R)-2-(4-methylphenyl)sulfonylazanidyl-1,2-diphenylethyl]azanide (PubChem CID 134848475) has the molecular formula C32H35ClN2O3RuS and a molecular weight of 664.23 g/mol. Its IUPAC name is carbanide;chlororuthenium(3+);2-[(4-methylphenyl)methoxy]ethyl-[(1R,2R)-2-(4-methylphenyl)sulfonylazanidyl-1,2-diphenylethyl]azanide.
| Compound Name | carbanide;chlororuthenium(3+);2-[(4-methylphenyl)methoxy]ethyl-[(1R,2R)-2-(4-methylphenyl)sulfonylazanidyl-1,2-diphenylethyl]azanide |
|---|---|
| PubChem CID | 134848475 |
| Molecular Formula | C32H35ClN2O3RuS |
| Molecular Weight | 664.23 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | carbanide;chlororuthenium(3+);2-[(4-methylphenyl)methoxy]ethyl-[(1R,2R)-2-(4-methylphenyl)sulfonylazanidyl-1,2-diphenylethyl]azanide |
| SMILES | Cc1ccc(COCC[N-][C@H](c2ccccc2)[C@H]([N-]S(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc1.Cl[Ru+3].[CH3-] |
| InChI | InChI=1S/C31H32N2O3S.CH3.ClH.Ru/c1-24-13-17-26(18-14-24)23-36-22-21-32-30(27-9-5-3-6-10-27)31(28-11-7-4-8-12-28)33-37(34,35)29-19-15-25(2)16-20-29;;;/h3-20,30-31H,21-23H2,1-2H3;1H3;1H;/q-2;-1;;+4/p-1/t30-,31-;;;/m1.../s1 |
| InChIKey | XSPCSWMZOHONMK-VSXGEILUSA-M |
| XLogP | 8.58 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.23 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|