C37H50N2 — CID 134848476
(3S,7R,15S)-3,7-dimethyl-8-(6-methylheptan-2-yl)-18,21-diazaheptacyclo[15.12.0.03,15.04,12.07,11.019,28.020,25]nonacosa-1(17),18,20(25),21,23,26,28-heptaene (PubChem CID 134848476) has the molecular formula C37H50N2 and a molecular weight of 522.82 g/mol. Its IUPAC name is (3S,7R,15S)-3,7-dimethyl-8-(6-methylheptan-2-yl)-18,21-diazaheptacyclo[15.12.0.03,15.04,12.07,11.019,28.020,25]nonacosa-1(17),18,20(25),21,23,26,28-heptaene.
| Compound Name | (3S,7R,15S)-3,7-dimethyl-8-(6-methylheptan-2-yl)-18,21-diazaheptacyclo[15.12.0.03,15.04,12.07,11.019,28.020,25]nonacosa-1(17),18,20(25),21,23,26,28-heptaene |
|---|---|
| PubChem CID | 134848476 |
| Molecular Formula | C37H50N2 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.40 |
| IUPAC Name | (3S,7R,15S)-3,7-dimethyl-8-(6-methylheptan-2-yl)-18,21-diazaheptacyclo[15.12.0.03,15.04,12.07,11.019,28.020,25]nonacosa-1(17),18,20(25),21,23,26,28-heptaene |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC[C@H]4Cc5nc6c(ccc7cccnc76)cc5C[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C37H50N2/c1-23(2)8-6-9-24(3)30-15-16-31-29-14-13-28-21-33-27(22-37(28,5)32(29)17-18-36(30,31)4)20-26-12-11-25-10-7-19-38-34(25)35(26)39-33/h7,10-12,19-20,23-24,28-32H,6,8-9,13-18,21-22H2,1-5H3/t24?,28-,29?,30?,31?,32?,36+,37-/m0/s1 |
| InChIKey | OKTGKQZXUPXVEL-LYAXNWDKSA-N |
| XLogP | 9.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|