C29H60O3Si2 — CID 134848525
(2R,3S,4S,5E,7E,9R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5,9-trimethyltrideca-5,7-dien-1-ol (PubChem CID 134848525) has the molecular formula C29H60O3Si2 and a molecular weight of 512.97 g/mol. Its IUPAC name is (2R,3S,4S,5E,7E,9R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5,9-trimethyltrideca-5,7-dien-1-ol.
| Compound Name | (2R,3S,4S,5E,7E,9R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5,9-trimethyltrideca-5,7-dien-1-ol |
|---|---|
| PubChem CID | 134848525 |
| Molecular Formula | C29H60O3Si2 |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 512.41 |
| IUPAC Name | (2R,3S,4S,5E,7E,9R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5,9-trimethyltrideca-5,7-dien-1-ol |
| SMILES | CCCC[C@@H](C)/C=C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](CO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H60O3Si2/c1-15-16-18-23(2)19-17-20-24(3)27(32-34(13,14)29(8,9)10)25(4)26(21-30)22-31-33(11,12)28(5,6)7/h17,19-20,23,25-27,30H,15-16,18,21-22H2,1-14H3/b19-17+,24-20+/t23-,25+,26-,27-/m1/s1 |
| InChIKey | HWYXMFYZTQUFHY-OOAIOGPESA-N |
| XLogP | 8.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|