C16H20FNO4 — CID 134848585
ethyl (3R,4S)-4-acetyloxy-1-benzyl-3-fluoropyrrolidine-3-carboxylate (PubChem CID 134848585) has the molecular formula C16H20FNO4 and a molecular weight of 309.34 g/mol. Its IUPAC name is ethyl (3R,4S)-4-acetyloxy-1-benzyl-3-fluoropyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R,4S)-4-acetyloxy-1-benzyl-3-fluoropyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 134848585 |
| Molecular Formula | C16H20FNO4 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | ethyl (3R,4S)-4-acetyloxy-1-benzyl-3-fluoropyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(F)CN(Cc2ccccc2)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H20FNO4/c1-3-21-15(20)16(17)11-18(10-14(16)22-12(2)19)9-13-7-5-4-6-8-13/h4-8,14H,3,9-11H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | LWNZKMJYEHGDOC-GOEBONIOSA-N |
| XLogP | 1.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |