C25H20N2O9 — CID 134848870
trimethyl (2R,5S)-5-benzoyl-1-(1,3-dioxoisoindol-2-yl)-2,5-dihydropyrrole-2,3,4-tricarboxylate (PubChem CID 134848870) has the molecular formula C25H20N2O9 and a molecular weight of 492.44 g/mol. Its IUPAC name is trimethyl (2R,5S)-5-benzoyl-1-(1,3-dioxoisoindol-2-yl)-2,5-dihydropyrrole-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2R,5S)-5-benzoyl-1-(1,3-dioxoisoindol-2-yl)-2,5-dihydropyrrole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 134848870 |
| Molecular Formula | C25H20N2O9 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | trimethyl (2R,5S)-5-benzoyl-1-(1,3-dioxoisoindol-2-yl)-2,5-dihydropyrrole-2,3,4-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H](C(=O)OC)N(N2C(=O)c3ccccc3C2=O)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20N2O9/c1-34-23(31)16-17(24(32)35-2)19(25(33)36-3)26(18(16)20(28)13-9-5-4-6-10-13)27-21(29)14-11-7-8-12-15(14)22(27)30/h4-12,18-19H,1-3H3/t18-,19+/m0/s1 |
| InChIKey | VAXRZKCLMHDTDX-RBUKOAKNSA-N |
| XLogP | 0.95 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|