About CID 134848919
CID 134848919 (PubChem CID 134848919) has the molecular formula C11H14NO
and a molecular weight of 176.24 g/mol.
Molecular Properties
| Compound Name | CID 134848919 |
| PubChem CID | 134848919 |
| Molecular Formula | C11H14NO |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | — |
| SMILES | OCc1ccccc1N1[CH]CCC1 |
| InChI | InChI=1S/C11H14NO/c13-9-10-5-1-2-6-11(10)12-7-3-4-8-12/h1-2,5-7,13H,3-4,8-9H2 |
| InChIKey | YSBNRLAJCTVHFO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 134848919 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134848919?
The IUPAC name of CID 134848919 (CID 134848919) is not available.
What is the SMILES notation for CID 134848919?
The canonical SMILES for CID 134848919 is OCc1ccccc1N1[CH]CCC1.
What is the InChIKey of CID 134848919?
The InChIKey is YSBNRLAJCTVHFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NO/c13-9-10-5-1-2-6-11(10)12-7-3-4-8-12/h1-2,5-7,13H,3-4,8-9H2.
What are the key properties of CID 134848919?
CID 134848919 has a molecular weight of 176.24 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134848919 is sourced from PubChem (CID 134848919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).