C15H23FN2O4 — CID 134849030
tert-butyl (3aR,4S,6S,6aS)-6-(cyanomethyl)-4-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 134849030) has the molecular formula C15H23FN2O4 and a molecular weight of 314.36 g/mol. Its IUPAC name is tert-butyl (3aR,4S,6S,6aS)-6-(cyanomethyl)-4-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,4S,6S,6aS)-6-(cyanomethyl)-4-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 134849030 |
| Molecular Formula | C15H23FN2O4 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | tert-butyl (3aR,4S,6S,6aS)-6-(cyanomethyl)-4-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CF)[C@H]2OC(C)(C)O[C@H]2[C@@H]1CC#N |
| InChI | InChI=1S/C15H23FN2O4/c1-14(2,3)22-13(19)18-9(6-7-17)11-12(10(18)8-16)21-15(4,5)20-11/h9-12H,6,8H2,1-5H3/t9-,10+,11-,12+/m0/s1 |
| InChIKey | JKTFPEUECPZULG-WHOHXGKFSA-N |
| XLogP | 2.38 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |