C21H19FO3S — CID 134849164
1-(4-fluorophenyl)sulfonyl-2-(4-phenylphenyl)propan-2-ol (PubChem CID 134849164) has the molecular formula C21H19FO3S and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-2-(4-phenylphenyl)propan-2-ol.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-2-(4-phenylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 134849164 |
| Molecular Formula | C21H19FO3S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-2-(4-phenylphenyl)propan-2-ol |
| SMILES | CC(O)(CS(=O)(=O)c1ccc(F)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19FO3S/c1-21(23,15-26(24,25)20-13-11-19(22)12-14-20)18-9-7-17(8-10-18)16-5-3-2-4-6-16/h2-14,23H,15H2,1H3 |
| InChIKey | XHZQYUZOSQLYQV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |