C24H31NO7 — CID 134849402
benzyl N-[(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-phenylmethoxybutan-2-yl]carbamate (PubChem CID 134849402) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is benzyl N-[(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-phenylmethoxybutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-phenylmethoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 134849402 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | benzyl N-[(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-phenylmethoxybutan-2-yl]carbamate |
| SMILES | CC1(C)OC[C@H]([C@@H](O)[C@H](O)[C@@H](COCc2ccccc2)NC(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C24H31NO7/c1-24(2)31-16-20(32-24)22(27)21(26)19(15-29-13-17-9-5-3-6-10-17)25-23(28)30-14-18-11-7-4-8-12-18/h3-12,19-22,26-27H,13-16H2,1-2H3,(H,25,28)/t19-,20-,21-,22-/m1/s1 |
| InChIKey | YJFCDGLNNOJCNN-GXRSIYKFSA-N |
| XLogP | 2.37 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |