C41H44N2O4S — CID 134849458
(E)-2-cyano-3-[3,3-dipentyl-8-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2,4-dihydrothieno[3,4-b][1,4]dioxepin-6-yl]prop-2-enoic acid (PubChem CID 134849458) has the molecular formula C41H44N2O4S and a molecular weight of 660.88 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,3-dipentyl-8-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2,4-dihydrothieno[3,4-b][1,4]dioxepin-6-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[3,3-dipentyl-8-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2,4-dihydrothieno[3,4-b][1,4]dioxepin-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134849458 |
| Molecular Formula | C41H44N2O4S |
| Molecular Weight | 660.88 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | (E)-2-cyano-3-[3,3-dipentyl-8-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2,4-dihydrothieno[3,4-b][1,4]dioxepin-6-yl]prop-2-enoic acid |
| SMILES | CCCCCC1(CCCCC)COc2c(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)sc(/C=C(\C#N)C(=O)O)c2OC1 |
| InChI | InChI=1S/C41H44N2O4S/c1-3-5-13-25-41(26-14-6-4-2)29-46-38-36(48-37(39(38)47-30-41)27-32(28-42)40(44)45)24-21-31-19-22-35(23-20-31)43(33-15-9-7-10-16-33)34-17-11-8-12-18-34/h7-12,15-24,27H,3-6,13-14,25-26,29-30H2,1-2H3,(H,44,45)/b24-21+,32-27+ |
| InChIKey | DBIKWFRYGSNYHY-KKEQATCYSA-N |
| XLogP | 11.30 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.88 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|