C27H35NO7 — CID 134849462
benzyl N-[(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-phenylmethoxybutan-2-yl]-N-prop-2-enylcarbamate (PubChem CID 134849462) has the molecular formula C27H35NO7 and a molecular weight of 485.58 g/mol. Its IUPAC name is benzyl N-[(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-phenylmethoxybutan-2-yl]-N-prop-2-enylcarbamate.
| Compound Name | benzyl N-[(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-phenylmethoxybutan-2-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 134849462 |
| Molecular Formula | C27H35NO7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | benzyl N-[(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-phenylmethoxybutan-2-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccccc1)[C@H](COCc1ccccc1)[C@@H](O)[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C27H35NO7/c1-4-15-28(26(31)33-17-21-13-9-6-10-14-21)22(18-32-16-20-11-7-5-8-12-20)24(29)25(30)23-19-34-27(2,3)35-23/h4-14,22-25,29-30H,1,15-19H2,2-3H3/t22-,23-,24-,25-/m1/s1 |
| InChIKey | ZKRWFLOPGDVFDY-ZGFBMJKBSA-N |
| XLogP | 3.27 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|