About methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate
methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate (PubChem CID 134849481) has the molecular formula C26H23NO3
and a molecular weight of 397.47 g/mol. Its IUPAC name is methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate.
Molecular Properties
| Compound Name | methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate |
| PubChem CID | 134849481 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate |
| SMILES | COC(=O)C1NC(c2ccccc2)C2(Cc3ccccc3C2=O)C1c1ccccc1 |
| InChI | InChI=1S/C26H23NO3/c1-30-25(29)22-21(17-10-4-2-5-11-17)26(23(27-22)18-12-6-3-7-13-18)16-19-14-8-9-15-20(19)24(26)28/h2-15,21-23,27H,16H2,1H3 |
| InChIKey | AHWFKYCHOXYVRJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate?
The IUPAC name of methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate (CID 134849481) is methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate.
What is the SMILES notation for methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate?
The canonical SMILES for methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate is COC(=O)C1NC(c2ccccc2)C2(Cc3ccccc3C2=O)C1c1ccccc1.
What is the InChIKey of methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate?
The InChIKey is AHWFKYCHOXYVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO3/c1-30-25(29)22-21(17-10-4-2-5-11-17)26(23(27-22)18-12-6-3-7-13-18)16-19-14-8-9-15-20(19)24(26)28/h2-15,21-23,27H,16H2,1H3.
What are the key properties of methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate?
methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate has a molecular weight of 397.47 g/mol, XLogP of 4.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-3',5'-diphenylspiro[1H-indene-2,4'-pyrrolidine]-2'-carboxylate is sourced from PubChem (CID 134849481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).