C13H19NO3 — CID 134849600
(2R,3S,4S,5S)-2-(4-methoxyphenyl)-1,5-dimethylpyrrolidine-3,4-diol (PubChem CID 134849600) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-(4-methoxyphenyl)-1,5-dimethylpyrrolidine-3,4-diol.
| Compound Name | (2R,3S,4S,5S)-2-(4-methoxyphenyl)-1,5-dimethylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 134849600 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (2R,3S,4S,5S)-2-(4-methoxyphenyl)-1,5-dimethylpyrrolidine-3,4-diol |
| SMILES | COc1ccc([C@@H]2[C@H](O)[C@@H](O)[C@H](C)N2C)cc1 |
| InChI | InChI=1S/C13H19NO3/c1-8-12(15)13(16)11(14(8)2)9-4-6-10(17-3)7-5-9/h4-8,11-13,15-16H,1-3H3/t8-,11+,12-,13-/m0/s1 |
| InChIKey | GJZNAEFHIYPPEM-MHNYQROPSA-N |
| XLogP | 0.79 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |