About tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate
tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate (PubChem CID 134849835) has the molecular formula C20H33NO4
and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate |
| PubChem CID | 134849835 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate |
| SMILES | CCC(=O)/C=C/CC[C@H]1CC[C@H](CC(=O)CC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO4/c1-6-17(22)11-9-8-10-15-12-13-16(14-18(23)7-2)21(15)19(24)25-20(3,4)5/h9,11,15-16H,6-8,10,12-14H2,1-5H3/b11-9+/t15-,16+/m0/s1 |
| InChIKey | ZGJWXXSLUAZWGQ-XLMABTLZSA-N |
| XLogP | 4.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate (CID 134849835) is tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate is CCC(=O)/C=C/CC[C@H]1CC[C@H](CC(=O)CC)N1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate?
The InChIKey is ZGJWXXSLUAZWGQ-XLMABTLZSA-N. The full InChI is InChI=1S/C20H33NO4/c1-6-17(22)11-9-8-10-15-12-13-16(14-18(23)7-2)21(15)19(24)25-20(3,4)5/h9,11,15-16H,6-8,10,12-14H2,1-5H3/b11-9+/t15-,16+/m0/s1.
What are the key properties of tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate?
tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate has a molecular weight of 351.49 g/mol, XLogP of 4.44, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,5S)-2-(2-oxobutyl)-5-[(E)-5-oxohept-3-enyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 134849835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).