About N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide
N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide (PubChem CID 134849892) has the molecular formula C18H18ClF2N3O2
and a molecular weight of 381.81 g/mol. Its IUPAC name is N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide |
| PubChem CID | 134849892 |
| Molecular Formula | C18H18ClF2N3O2 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide |
| SMILES | O=C(NCCCC(F)(F)C(=O)NCc1ccccc1)c1cccnc1Cl |
| InChI | InChI=1S/C18H18ClF2N3O2/c19-15-14(8-4-10-22-15)16(25)23-11-5-9-18(20,21)17(26)24-12-13-6-2-1-3-7-13/h1-4,6-8,10H,5,9,11-12H2,(H,23,25)(H,24,26) |
| InChIKey | KOAFKITZFODBIR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide?
The IUPAC name of N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide (CID 134849892) is N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide.
What is the SMILES notation for N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide?
The canonical SMILES for N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide is O=C(NCCCC(F)(F)C(=O)NCc1ccccc1)c1cccnc1Cl.
What is the InChIKey of N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide?
The InChIKey is KOAFKITZFODBIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClF2N3O2/c19-15-14(8-4-10-22-15)16(25)23-11-5-9-18(20,21)17(26)24-12-13-6-2-1-3-7-13/h1-4,6-8,10H,5,9,11-12H2,(H,23,25)(H,24,26).
What are the key properties of N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide?
N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide has a molecular weight of 381.81 g/mol, XLogP of 3.20, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(benzylamino)-4,4-difluoro-5-oxopentyl]-2-chloropyridine-3-carboxamide is sourced from PubChem (CID 134849892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).