C14H9F7N2O — CID 134850035
N-[5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)quinolin-8-yl]acetamide (PubChem CID 134850035) has the molecular formula C14H9F7N2O and a molecular weight of 354.23 g/mol. Its IUPAC name is N-[5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)quinolin-8-yl]acetamide.
| Compound Name | N-[5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)quinolin-8-yl]acetamide |
|---|---|
| PubChem CID | 134850035 |
| Molecular Formula | C14H9F7N2O |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-[5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)quinolin-8-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)c2cccnc12 |
| InChI | InChI=1S/C14H9F7N2O/c1-7(24)23-10-5-4-9(8-3-2-6-22-11(8)10)12(15,13(16,17)18)14(19,20)21/h2-6H,1H3,(H,23,24) |
| InChIKey | SPQHWHNRXLHKAZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |