C10H12F3O3SSi+ — CID 134850248
(2-trimethylsilylcyclohexa-1,3,5-trien-1-yl) trifluoromethanesulfonate (PubChem CID 134850248) has the molecular formula C10H12F3O3SSi+ and a molecular weight of 297.35 g/mol. Its IUPAC name is (2-trimethylsilylcyclohexa-1,3,5-trien-1-yl) trifluoromethanesulfonate.
| Compound Name | (2-trimethylsilylcyclohexa-1,3,5-trien-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134850248 |
| Molecular Formula | C10H12F3O3SSi+ |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | (2-trimethylsilylcyclohexa-1,3,5-trien-1-yl) trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)C1=C(OS(=O)(=O)C(F)(F)F)C=C[C+]=C1 |
| InChI | InChI=1S/C10H12F3O3SSi/c1-18(2,3)9-7-5-4-6-8(9)16-17(14,15)10(11,12)13/h4,6-7H,1-3H3/q+1 |
| InChIKey | GJCLNHKCPNGYQN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|