C17H14FNO3 — CID 134850329
2-[(2S,3R)-3-fluoro-2-hydroxy-3-phenylpropyl]isoindole-1,3-dione (PubChem CID 134850329) has the molecular formula C17H14FNO3 and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-[(2S,3R)-3-fluoro-2-hydroxy-3-phenylpropyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R)-3-fluoro-2-hydroxy-3-phenylpropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134850329 |
| Molecular Formula | C17H14FNO3 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-[(2S,3R)-3-fluoro-2-hydroxy-3-phenylpropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H](O)[C@H](F)c1ccccc1 |
| InChI | InChI=1S/C17H14FNO3/c18-15(11-6-2-1-3-7-11)14(20)10-19-16(21)12-8-4-5-9-13(12)17(19)22/h1-9,14-15,20H,10H2/t14-,15+/m0/s1 |
| InChIKey | FBOKRTJLFNHOCV-LSDHHAIUSA-N |
| XLogP | 2.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|