About 2-chloronaphtho[2,1-b][1]benzofuran
2-chloronaphtho[2,1-b][1]benzofuran (PubChem CID 134850342) has the molecular formula C16H9ClO
and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-chloronaphtho[2,1-b][1]benzofuran.
Molecular Properties
| Compound Name | 2-chloronaphtho[2,1-b][1]benzofuran |
| PubChem CID | 134850342 |
| Molecular Formula | C16H9ClO |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 2-chloronaphtho[2,1-b][1]benzofuran |
| SMILES | Clc1ccc2ccc3oc4ccccc4c3c2c1 |
| InChI | InChI=1S/C16H9ClO/c17-11-7-5-10-6-8-15-16(13(10)9-11)12-3-1-2-4-14(12)18-15/h1-9H |
| InChIKey | USTIKRUUINEQNX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloronaphtho[2,1-b][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloronaphtho[2,1-b][1]benzofuran?
The IUPAC name of 2-chloronaphtho[2,1-b][1]benzofuran (CID 134850342) is 2-chloronaphtho[2,1-b][1]benzofuran.
What is the SMILES notation for 2-chloronaphtho[2,1-b][1]benzofuran?
The canonical SMILES for 2-chloronaphtho[2,1-b][1]benzofuran is Clc1ccc2ccc3oc4ccccc4c3c2c1.
What is the InChIKey of 2-chloronaphtho[2,1-b][1]benzofuran?
The InChIKey is USTIKRUUINEQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClO/c17-11-7-5-10-6-8-15-16(13(10)9-11)12-3-1-2-4-14(12)18-15/h1-9H.
What are the key properties of 2-chloronaphtho[2,1-b][1]benzofuran?
2-chloronaphtho[2,1-b][1]benzofuran has a molecular weight of 252.70 g/mol, XLogP of 5.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloronaphtho[2,1-b][1]benzofuran is sourced from PubChem (CID 134850342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).