About (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one
(4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 134850382) has the molecular formula C19H21NO4
and a molecular weight of 327.38 g/mol. Its IUPAC name is (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
| PubChem CID | 134850382 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CC2(O)[C@@H](O)CC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H21NO4/c1-24-16-9-7-14(8-10-16)12-19(23)17(21)11-18(22)20(19)13-15-5-3-2-4-6-15/h2-10,17,21,23H,11-13H2,1H3/t17-,19?/m0/s1 |
| InChIKey | GOKUVQLEZLVTGG-KKFHFHRHSA-N |
| XLogP | 1.72 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one?
The IUPAC name of (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one (CID 134850382) is (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one.
What is the SMILES notation for (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one?
The canonical SMILES for (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one is COc1ccc(CC2(O)[C@@H](O)CC(=O)N2Cc2ccccc2)cc1.
What is the InChIKey of (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one?
The InChIKey is GOKUVQLEZLVTGG-KKFHFHRHSA-N. The full InChI is InChI=1S/C19H21NO4/c1-24-16-9-7-14(8-10-16)12-19(23)17(21)11-18(22)20(19)13-15-5-3-2-4-6-15/h2-10,17,21,23H,11-13H2,1H3/t17-,19?/m0/s1.
What are the key properties of (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one?
(4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one has a molecular weight of 327.38 g/mol, XLogP of 1.72, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-benzyl-4,5-dihydroxy-5-[(4-methoxyphenyl)methyl]pyrrolidin-2-one is sourced from PubChem (CID 134850382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).