C20H23NO9 — CID 134850405
diethyl 2-(4-ethoxycarbonyl-2-methoxy-1,3-dioxoisoquinolin-4-yl)propanedioate (PubChem CID 134850405) has the molecular formula C20H23NO9 and a molecular weight of 421.40 g/mol. Its IUPAC name is diethyl 2-(4-ethoxycarbonyl-2-methoxy-1,3-dioxoisoquinolin-4-yl)propanedioate.
| Compound Name | diethyl 2-(4-ethoxycarbonyl-2-methoxy-1,3-dioxoisoquinolin-4-yl)propanedioate |
|---|---|
| PubChem CID | 134850405 |
| Molecular Formula | C20H23NO9 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | diethyl 2-(4-ethoxycarbonyl-2-methoxy-1,3-dioxoisoquinolin-4-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1(C(=O)OCC)C(=O)N(OC)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H23NO9/c1-5-28-16(23)14(17(24)29-6-2)20(19(26)30-7-3)13-11-9-8-10-12(13)15(22)21(27-4)18(20)25/h8-11,14H,5-7H2,1-4H3 |
| InChIKey | MPHOUKMOLRIOON-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|