About (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium
(2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium (PubChem CID 134850476) has the molecular formula C7H5ClOY-2
and a molecular weight of 229.48 g/mol. Its IUPAC name is (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium.
Molecular Properties
| Compound Name | (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium |
| PubChem CID | 134850476 |
| Molecular Formula | C7H5ClOY-2 |
| Molecular Weight | 229.48 g/mol |
| Exact Mass | 228.91 |
| IUPAC Name | (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium |
| SMILES | [H]/[C-]=C(/C=[C-]/[H])\C=C\C(=O)Cl.[Y] |
| InChI | InChI=1S/C7H5ClO.Y/c1-3-6(2)4-5-7(8)9;/h1-5H;/q-2;/b5-4+; |
| InChIKey | YASWRLDZPRZLDJ-FXRZFVDSSA-N |
| XLogP | 1.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium?
The IUPAC name of (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium (CID 134850476) is (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium.
What is the SMILES notation for (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium?
The canonical SMILES for (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium is [H]/[C-]=C(/C=[C-]/[H])\C=C\C(=O)Cl.[Y].
What is the InChIKey of (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium?
The InChIKey is YASWRLDZPRZLDJ-FXRZFVDSSA-N. The full InChI is InChI=1S/C7H5ClO.Y/c1-3-6(2)4-5-7(8)9;/h1-5H;/q-2;/b5-4+;.
What are the key properties of (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium?
(2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium has a molecular weight of 229.48 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-methanidylidenehexa-2,5-dienoyl chloride;yttrium is sourced from PubChem (CID 134850476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).