C23H28O11S — CID 134850594
[(2R)-2-acetyloxy-2-[(3S,6S)-3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl]ethyl] acetate (PubChem CID 134850594) has the molecular formula C23H28O11S and a molecular weight of 512.53 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-2-[(3S,6S)-3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl]ethyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-2-[(3S,6S)-3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 134850594 |
| Molecular Formula | C23H28O11S |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | [(2R)-2-acetyloxy-2-[(3S,6S)-3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)C1O[C@@H](Sc2ccccc2)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H28O11S/c1-12(24)29-11-18(30-13(2)25)19-20(31-14(3)26)21(32-15(4)27)22(33-16(5)28)23(34-19)35-17-9-7-6-8-10-17/h6-10,18-23H,11H2,1-5H3/t18-,19?,20-,21?,22?,23+/m1/s1 |
| InChIKey | CANCNEZXEPNNCA-IAONQCPOSA-N |
| XLogP | 1.79 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|