About benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate
benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate (PubChem CID 134850650) has the molecular formula C36H37NO5
and a molecular weight of 563.69 g/mol. Its IUPAC name is benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate |
| PubChem CID | 134850650 |
| Molecular Formula | C36H37NO5 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate |
| SMILES | C=CC1[C@@H](OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H37NO5/c1-2-32-34(40-25-29-17-9-4-10-18-29)35(41-26-30-19-11-5-12-20-30)33(39-24-28-15-7-3-8-16-28)23-37(32)36(38)42-27-31-21-13-6-14-22-31/h2-22,32-35H,1,23-27H2/t32?,33?,34-,35?/m1/s1 |
| InChIKey | YNCGNHCGQMILHX-JERBRLGVSA-N |
| XLogP | 6.95 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate?
The IUPAC name of benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate (CID 134850650) is benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate.
What is the SMILES notation for benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate?
The canonical SMILES for benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate is C=CC1[C@@H](OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)CN1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate?
The InChIKey is YNCGNHCGQMILHX-JERBRLGVSA-N. The full InChI is InChI=1S/C36H37NO5/c1-2-32-34(40-25-29-17-9-4-10-18-29)35(41-26-30-19-11-5-12-20-30)33(39-24-28-15-7-3-8-16-28)23-37(32)36(38)42-27-31-21-13-6-14-22-31/h2-22,32-35H,1,23-27H2/t32?,33?,34-,35?/m1/s1.
What are the key properties of benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate?
benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate has a molecular weight of 563.69 g/mol, XLogP of 6.95, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3R)-2-ethenyl-3,4,5-tris(phenylmethoxy)piperidine-1-carboxylate is sourced from PubChem (CID 134850650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).