C27H44O5Si — CID 134850672
methyl 2-methoxy-6-[[(2R,4R,6R)-6-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]methyl]benzoate (PubChem CID 134850672) has the molecular formula C27H44O5Si and a molecular weight of 476.73 g/mol. Its IUPAC name is methyl 2-methoxy-6-[[(2R,4R,6R)-6-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]methyl]benzoate.
| Compound Name | methyl 2-methoxy-6-[[(2R,4R,6R)-6-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 134850672 |
| Molecular Formula | C27H44O5Si |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | methyl 2-methoxy-6-[[(2R,4R,6R)-6-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]methyl]benzoate |
| SMILES | C=CC[C@@H]1C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H](Cc2cccc(OC)c2C(=O)OC)O1 |
| InChI | InChI=1S/C27H44O5Si/c1-10-12-22-16-24(32-33(18(2)3,19(4)5)20(6)7)17-23(31-22)15-21-13-11-14-25(29-8)26(21)27(28)30-9/h10-11,13-14,18-20,22-24H,1,12,15-17H2,2-9H3/t22-,23-,24-/m1/s1 |
| InChIKey | ORMIRJYPBZAUQU-WXFUMESZSA-N |
| XLogP | 6.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|