C22H22O2S — CID 134850709
9-benzylsulfanyl-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one (PubChem CID 134850709) has the molecular formula C22H22O2S and a molecular weight of 350.48 g/mol. Its IUPAC name is 9-benzylsulfanyl-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one.
| Compound Name | 9-benzylsulfanyl-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 134850709 |
| Molecular Formula | C22H22O2S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 9-benzylsulfanyl-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1ccccc1C2SCc1ccccc1 |
| InChI | InChI=1S/C22H22O2S/c1-22(2)12-17(23)20-19(13-22)24-18-11-7-6-10-16(18)21(20)25-14-15-8-4-3-5-9-15/h3-11,21H,12-14H2,1-2H3 |
| InChIKey | BWAJBALUPWPNBI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |